C7H14N2S — CID 22467178
1-thia-4,8-diazaspiro[4.5]decane (PubChem CID 22467178) has the molecular formula C7H14N2S and a molecular weight of 158.27 g/mol. Its IUPAC name is 1-thia-4,8-diazaspiro[4.5]decane.
| Compound Name | 1-thia-4,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 22467178 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 1-thia-4,8-diazaspiro[4.5]decane |
| SMILES | C1CC2(CCN1)NCCS2 |
| InChI | InChI=1S/C7H14N2S/c1-3-8-4-2-7(1)9-5-6-10-7/h8-9H,1-6H2 |
| InChIKey | GIIKVRLLDPVVMC-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |