C8H15IN2S — CID 134389589
9-iodo-1-thia-5,9-diazaspiro[5.5]undecane (PubChem CID 134389589) has the molecular formula C8H15IN2S and a molecular weight of 298.19 g/mol. Its IUPAC name is 9-iodo-1-thia-5,9-diazaspiro[5.5]undecane.
| Compound Name | 9-iodo-1-thia-5,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 134389589 |
| Molecular Formula | C8H15IN2S |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 9-iodo-1-thia-5,9-diazaspiro[5.5]undecane |
| SMILES | IN1CCC2(CC1)NCCCS2 |
| InChI | InChI=1S/C8H15IN2S/c9-11-5-2-8(3-6-11)10-4-1-7-12-8/h10H,1-7H2 |
| InChIKey | UYDZLACNSYIQGC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|