C13H24N2O2S — CID 130490562
tert-butyl 1-thia-5,9-diazaspiro[5.5]undecane-9-carboxylate (PubChem CID 130490562) has the molecular formula C13H24N2O2S and a molecular weight of 272.41 g/mol. Its IUPAC name is tert-butyl 1-thia-5,9-diazaspiro[5.5]undecane-9-carboxylate.
| Compound Name | tert-butyl 1-thia-5,9-diazaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 130490562 |
| Molecular Formula | C13H24N2O2S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | tert-butyl 1-thia-5,9-diazaspiro[5.5]undecane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)NCCCS2 |
| InChI | InChI=1S/C13H24N2O2S/c1-12(2,3)17-11(16)15-8-5-13(6-9-15)14-7-4-10-18-13/h14H,4-10H2,1-3H3 |
| InChIKey | UZTCWOUTBINFTG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |