About 3-ethyl-7,7-dimethyl-1-thia-4,8-diazaspiro[4.5]decane
3-ethyl-7,7-dimethyl-1-thia-4,8-diazaspiro[4.5]decane (PubChem CID 164646753) has the molecular formula C11H22N2S
and a molecular weight of 214.38 g/mol. Its IUPAC name is 3-ethyl-7,7-dimethyl-1-thia-4,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 3-ethyl-7,7-dimethyl-1-thia-4,8-diazaspiro[4.5]decane |
| PubChem CID | 164646753 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 3-ethyl-7,7-dimethyl-1-thia-4,8-diazaspiro[4.5]decane |
| SMILES | CCC1CSC2(CCNC(C)(C)C2)N1 |
| InChI | InChI=1S/C11H22N2S/c1-4-9-7-14-11(13-9)5-6-12-10(2,3)8-11/h9,12-13H,4-8H2,1-3H3 |
| InChIKey | YHQWBUILWYXNTB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-7,7-dimethyl-1-thia-4,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-7,7-dimethyl-1-thia-4,8-diazaspiro[4.5]decane?
The IUPAC name of 3-ethyl-7,7-dimethyl-1-thia-4,8-diazaspiro[4.5]decane (CID 164646753) is 3-ethyl-7,7-dimethyl-1-thia-4,8-diazaspiro[4.5]decane.
What is the SMILES notation for 3-ethyl-7,7-dimethyl-1-thia-4,8-diazaspiro[4.5]decane?
The canonical SMILES for 3-ethyl-7,7-dimethyl-1-thia-4,8-diazaspiro[4.5]decane is CCC1CSC2(CCNC(C)(C)C2)N1.
What is the InChIKey of 3-ethyl-7,7-dimethyl-1-thia-4,8-diazaspiro[4.5]decane?
The InChIKey is YHQWBUILWYXNTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2S/c1-4-9-7-14-11(13-9)5-6-12-10(2,3)8-11/h9,12-13H,4-8H2,1-3H3.
What are the key properties of 3-ethyl-7,7-dimethyl-1-thia-4,8-diazaspiro[4.5]decane?
3-ethyl-7,7-dimethyl-1-thia-4,8-diazaspiro[4.5]decane has a molecular weight of 214.38 g/mol, XLogP of 1.96, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-7,7-dimethyl-1-thia-4,8-diazaspiro[4.5]decane is sourced from PubChem (CID 164646753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).