C10H19NS — CID 130709676
7-ethyl-2,3-dimethyl-5-thia-8-azaspiro[3.4]octane (PubChem CID 130709676) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is 7-ethyl-2,3-dimethyl-5-thia-8-azaspiro[3.4]octane.
| Compound Name | 7-ethyl-2,3-dimethyl-5-thia-8-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 130709676 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 7-ethyl-2,3-dimethyl-5-thia-8-azaspiro[3.4]octane |
| SMILES | CCC1CSC2(CC(C)C2C)N1 |
| InChI | InChI=1S/C10H19NS/c1-4-9-6-12-10(11-9)5-7(2)8(10)3/h7-9,11H,4-6H2,1-3H3 |
| InChIKey | MWBGBFFUZQYIMW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |