C19H23N3O3 — CID 129006594
2-(furan-3-yl)-1-[3-[(2-pyrrolidin-1-yl-3-pyridinyl)oxy]pyrrolidin-1-yl]ethanone (PubChem CID 129006594) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-(furan-3-yl)-1-[3-[(2-pyrrolidin-1-yl-3-pyridinyl)oxy]pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(furan-3-yl)-1-[3-[(2-pyrrolidin-1-yl-3-pyridinyl)oxy]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 129006594 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-(furan-3-yl)-1-[3-[(2-pyrrolidin-1-yl-3-pyridinyl)oxy]pyrrolidin-1-yl]ethanone |
| SMILES | O=C(Cc1ccoc1)N1CCC(Oc2cccnc2N2CCCC2)C1 |
| InChI | InChI=1S/C19H23N3O3/c23-18(12-15-6-11-24-14-15)22-10-5-16(13-22)25-17-4-3-7-20-19(17)21-8-1-2-9-21/h3-4,6-7,11,14,16H,1-2,5,8-10,12-13H2 |
| InChIKey | SAJNVGHVJUGIIL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |