C15H22N6OS — CID 129007005
[4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-(4-ethylthiadiazol-5-yl)methanone (PubChem CID 129007005) has the molecular formula C15H22N6OS and a molecular weight of 334.45 g/mol. Its IUPAC name is [4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-(4-ethylthiadiazol-5-yl)methanone.
| Compound Name | [4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-(4-ethylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 129007005 |
| Molecular Formula | C15H22N6OS |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | [4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-(4-ethylthiadiazol-5-yl)methanone |
| SMILES | CCc1nnsc1C(=O)N1CCN(CC)C(c2nccn2C)C1 |
| InChI | InChI=1S/C15H22N6OS/c1-4-11-13(23-18-17-11)15(22)21-9-8-20(5-2)12(10-21)14-16-6-7-19(14)3/h6-7,12H,4-5,8-10H2,1-3H3 |
| InChIKey | NHGREOIERQXTRF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |