C14H20N6OS — CID 129478872
(4-ethylthiadiazol-5-yl)-[(3S)-4-methyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]methanone (PubChem CID 129478872) has the molecular formula C14H20N6OS and a molecular weight of 320.42 g/mol. Its IUPAC name is (4-ethylthiadiazol-5-yl)-[(3S)-4-methyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]methanone.
| Compound Name | (4-ethylthiadiazol-5-yl)-[(3S)-4-methyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 129478872 |
| Molecular Formula | C14H20N6OS |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (4-ethylthiadiazol-5-yl)-[(3S)-4-methyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]methanone |
| SMILES | CCc1nnsc1C(=O)N1CCN(C)[C@H](c2nccn2C)C1 |
| InChI | InChI=1S/C14H20N6OS/c1-4-10-12(22-17-16-10)14(21)20-8-7-18(2)11(9-20)13-15-5-6-19(13)3/h5-6,11H,4,7-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | QIBLBKJSMDEALQ-NSHDSACASA-N |
| XLogP | 0.96 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |