C15H26N2O6S — CID 129008288
2-[[4-(cyclohexanecarbonyl)morpholin-2-yl]methyl-methylsulfonylamino]acetic acid (PubChem CID 129008288) has the molecular formula C15H26N2O6S and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-[[4-(cyclohexanecarbonyl)morpholin-2-yl]methyl-methylsulfonylamino]acetic acid.
| Compound Name | 2-[[4-(cyclohexanecarbonyl)morpholin-2-yl]methyl-methylsulfonylamino]acetic acid |
|---|---|
| PubChem CID | 129008288 |
| Molecular Formula | C15H26N2O6S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-[[4-(cyclohexanecarbonyl)morpholin-2-yl]methyl-methylsulfonylamino]acetic acid |
| SMILES | CS(=O)(=O)N(CC(=O)O)CC1CN(C(=O)C2CCCCC2)CCO1 |
| InChI | InChI=1S/C15H26N2O6S/c1-24(21,22)17(11-14(18)19)10-13-9-16(7-8-23-13)15(20)12-5-3-2-4-6-12/h12-13H,2-11H2,1H3,(H,18,19) |
| InChIKey | ZUOWFMWYELTVCL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |