C18H24N4O4 — CID 129009431
N-(4-methoxyphenyl)-2-oxo-2-[3-(2-oxopiperazin-1-yl)piperidin-1-yl]acetamide (PubChem CID 129009431) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-oxo-2-[3-(2-oxopiperazin-1-yl)piperidin-1-yl]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-oxo-2-[3-(2-oxopiperazin-1-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 129009431 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-(4-methoxyphenyl)-2-oxo-2-[3-(2-oxopiperazin-1-yl)piperidin-1-yl]acetamide |
| SMILES | COc1ccc(NC(=O)C(=O)N2CCCC(N3CCNCC3=O)C2)cc1 |
| InChI | InChI=1S/C18H24N4O4/c1-26-15-6-4-13(5-7-15)20-17(24)18(25)21-9-2-3-14(12-21)22-10-8-19-11-16(22)23/h4-7,14,19H,2-3,8-12H2,1H3,(H,20,24) |
| InChIKey | ZDVCNFHEPNWPGI-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|