C21H30O2 — CID 129009601
(3S,7R,8R,9S,13S,14S,17R)-16,16-dideuterio-17-ethynyl-13-methyl-7-(trideuteriomethyl)-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 129009601) has the molecular formula C21H30O2 and a molecular weight of 319.50 g/mol. Its IUPAC name is (3S,7R,8R,9S,13S,14S,17R)-16,16-dideuterio-17-ethynyl-13-methyl-7-(trideuteriomethyl)-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (3S,7R,8R,9S,13S,14S,17R)-16,16-dideuterio-17-ethynyl-13-methyl-7-(trideuteriomethyl)-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 129009601 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | (3S,7R,8R,9S,13S,14S,17R)-16,16-dideuterio-17-ethynyl-13-methyl-7-(trideuteriomethyl)-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | [2H]C([2H])([2H])[C@@H]1CC2=C(CC[C@H](O)C2)[C@H]2CC[C@@]3(C)[C@@H](CC([2H])([2H])[C@@]3(O)C#C)[C@@H]21 |
| InChI | InChI=1S/C21H30O2/c1-4-21(23)10-8-18-19-13(2)11-14-12-15(22)5-6-16(14)17(19)7-9-20(18,21)3/h1,13,15,17-19,22-23H,5-12H2,2-3H3/t13-,15+,17-,18+,19-,20+,21+/m1/s1/i2D3,10D2 |
| InChIKey | YLEUWNOTNJZCBN-QMLFJLJGSA-N |
| XLogP | 3.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|