C24H34O2 — CID 87983764
(3R,8S,9S,11S,13S,14S,17S)-11-but-3-enyl-17-ethynyl-13-methyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 87983764) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is (3R,8S,9S,11S,13S,14S,17S)-11-but-3-enyl-17-ethynyl-13-methyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (3R,8S,9S,11S,13S,14S,17S)-11-but-3-enyl-17-ethynyl-13-methyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 87983764 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (3R,8S,9S,11S,13S,14S,17S)-11-but-3-enyl-17-ethynyl-13-methyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C#C[C@@]1(O)CC[C@H]2[C@@H]3CCC4=C(CC[C@@H](O)C4)[C@H]3[C@@H](CCC=C)C[C@@]21C |
| InChI | InChI=1S/C24H34O2/c1-4-6-7-17-15-23(3)21(12-13-24(23,26)5-2)20-10-8-16-14-18(25)9-11-19(16)22(17)20/h2,4,17-18,20-22,25-26H,1,6-15H2,3H3/t17-,18+,20-,21-,22+,23-,24+/m0/s1 |
| InChIKey | RXETTXFCHXNUIC-DXEMIQJKSA-N |
| XLogP | 4.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|