C26H46O3 — CID 142111713
ethane;methanol;(17S)-3-methoxy-13,17-dimethyl-11-prop-2-enyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 142111713) has the molecular formula C26H46O3 and a molecular weight of 406.65 g/mol. Its IUPAC name is ethane;methanol;(17S)-3-methoxy-13,17-dimethyl-11-prop-2-enyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | ethane;methanol;(17S)-3-methoxy-13,17-dimethyl-11-prop-2-enyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 142111713 |
| Molecular Formula | C26H46O3 |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.34 |
| IUPAC Name | ethane;methanol;(17S)-3-methoxy-13,17-dimethyl-11-prop-2-enyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C=CCC1CC2(C)C(CC[C@]2(C)O)C2CCC3=C(CCC(OC)C3)C12.CC.CO |
| InChI | InChI=1S/C23H36O2.C2H6.CH4O/c1-5-6-16-14-22(2)20(11-12-23(22,3)24)19-9-7-15-13-17(25-4)8-10-18(15)21(16)19;2*1-2/h5,16-17,19-21,24H,1,6-14H2,2-4H3;1-2H3;2H,1H3/t16?,17?,19?,20?,21?,22?,23-;;/m0../s1 |
| InChIKey | GLQGTOCHAFZRHJ-UFKLFWKHSA-N |
| XLogP | 5.91 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|