C24H35NO2 — CID 142047712
7-(4-amino-3-hydroxyhex-1-yn-3-yl)-7-methyl-5-prop-2-enyl-1,3,4,4b,5,6,8,8a,9,10-decahydrophenanthren-2-one (PubChem CID 142047712) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is 7-(4-amino-3-hydroxyhex-1-yn-3-yl)-7-methyl-5-prop-2-enyl-1,3,4,4b,5,6,8,8a,9,10-decahydrophenanthren-2-one.
| Compound Name | 7-(4-amino-3-hydroxyhex-1-yn-3-yl)-7-methyl-5-prop-2-enyl-1,3,4,4b,5,6,8,8a,9,10-decahydrophenanthren-2-one |
|---|---|
| PubChem CID | 142047712 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | 7-(4-amino-3-hydroxyhex-1-yn-3-yl)-7-methyl-5-prop-2-enyl-1,3,4,4b,5,6,8,8a,9,10-decahydrophenanthren-2-one |
| SMILES | C#CC(O)(C(N)CC)C1(C)CC(CC=C)C2C3=C(CCC2C1)CC(=O)CC3 |
| InChI | InChI=1S/C24H35NO2/c1-5-8-17-14-23(4,24(27,7-3)21(25)6-2)15-18-10-9-16-13-19(26)11-12-20(16)22(17)18/h3,5,17-18,21-22,27H,1,6,8-15,25H2,2,4H3 |
| InChIKey | VGFORMJUGAKSTM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|