C21H28O4 — CID 42613213
(7R,8R,9S,11R,13S,14S,15R,17R)-17-ethynyl-11,15,17-trihydroxy-7,13-dimethyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 42613213) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (7R,8R,9S,11R,13S,14S,15R,17R)-17-ethynyl-11,15,17-trihydroxy-7,13-dimethyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (7R,8R,9S,11R,13S,14S,15R,17R)-17-ethynyl-11,15,17-trihydroxy-7,13-dimethyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 42613213 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (7R,8R,9S,11R,13S,14S,15R,17R)-17-ethynyl-11,15,17-trihydroxy-7,13-dimethyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C#C[C@]1(O)C[C@@H](O)[C@H]2[C@H]3[C@@H](C4=C(CC(=O)CC4)C[C@H]3C)[C@H](O)C[C@@]21C |
| InChI | InChI=1S/C21H28O4/c1-4-21(25)10-16(24)19-17-11(2)7-12-8-13(22)5-6-14(12)18(17)15(23)9-20(19,21)3/h1,11,15-19,23-25H,5-10H2,2-3H3/t11-,15-,16-,17-,18+,19+,20+,21+/m1/s1 |
| InChIKey | LHAGAJWRQRSJFP-VZKPGFRCSA-N |
| XLogP | 1.82 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|