C20H28O2 — CID 90907884
(7R,11S,13S,17S)-17-hydroxy-7,11,13-trimethyl-2,4,6,7,8,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 90907884) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (7R,11S,13S,17S)-17-hydroxy-7,11,13-trimethyl-2,4,6,7,8,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (7R,11S,13S,17S)-17-hydroxy-7,11,13-trimethyl-2,4,6,7,8,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 90907884 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (7R,11S,13S,17S)-17-hydroxy-7,11,13-trimethyl-2,4,6,7,8,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1CC2=C(CCC(=O)C2)C2C1C1=CC[C@H](O)[C@@]1(C)C[C@@H]2C |
| InChI | InChI=1S/C20H28O2/c1-11-8-13-9-14(21)4-5-15(13)18-12(2)10-20(3)16(19(11)18)6-7-17(20)22/h6,11-12,17-19,22H,4-5,7-10H2,1-3H3/t11-,12+,17+,18?,19?,20+/m1/s1 |
| InChIKey | RIDSIECKPKEBLZ-LQNZEJBMSA-N |
| XLogP | 4.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|