C22H32O2 — CID 131724378
(1R,2R,4S,6S,7R,10S,18R)-6-(2-hydroxyethyl)-7,18-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-11(16)-en-14-one (PubChem CID 131724378) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is (1R,2R,4S,6S,7R,10S,18R)-6-(2-hydroxyethyl)-7,18-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-11(16)-en-14-one.
| Compound Name | (1R,2R,4S,6S,7R,10S,18R)-6-(2-hydroxyethyl)-7,18-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-11(16)-en-14-one |
|---|---|
| PubChem CID | 131724378 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (1R,2R,4S,6S,7R,10S,18R)-6-(2-hydroxyethyl)-7,18-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-11(16)-en-14-one |
| SMILES | C[C@@H]1CC2=C(CCC(=O)C2)[C@H]2CC[C@]3(C)[C@H](CCO)C[C@H]4C[C@]43[C@H]12 |
| InChI | InChI=1S/C22H32O2/c1-13-9-14-10-17(24)3-4-18(14)19-5-7-21(2)15(6-8-23)11-16-12-22(16,21)20(13)19/h13,15-16,19-20,23H,3-12H2,1-2H3/t13-,15-,16+,19-,20-,21-,22-/m1/s1 |
| InChIKey | IUEQJPZZQJVXSH-UCQBJZDCSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|