C21H32O3 — CID 18635339
(4aS,4bS,7R,8aS,10aR)-10a-hydroxy-7-(2-hydroxypropan-2-yl)-7-methyl-4a-prop-2-ynyl-1,3,4,4b,5,6,8,8a,9,10-decahydrophenanthren-2-one (PubChem CID 18635339) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (4aS,4bS,7R,8aS,10aR)-10a-hydroxy-7-(2-hydroxypropan-2-yl)-7-methyl-4a-prop-2-ynyl-1,3,4,4b,5,6,8,8a,9,10-decahydrophenanthren-2-one.
| Compound Name | (4aS,4bS,7R,8aS,10aR)-10a-hydroxy-7-(2-hydroxypropan-2-yl)-7-methyl-4a-prop-2-ynyl-1,3,4,4b,5,6,8,8a,9,10-decahydrophenanthren-2-one |
|---|---|
| PubChem CID | 18635339 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (4aS,4bS,7R,8aS,10aR)-10a-hydroxy-7-(2-hydroxypropan-2-yl)-7-methyl-4a-prop-2-ynyl-1,3,4,4b,5,6,8,8a,9,10-decahydrophenanthren-2-one |
| SMILES | C#CC[C@]12CCC(=O)C[C@]1(O)CC[C@H]1C[C@](C)(C(C)(C)O)CC[C@@H]12 |
| InChI | InChI=1S/C21H32O3/c1-5-9-20-11-7-16(22)14-21(20,24)12-6-15-13-19(4,18(2,3)23)10-8-17(15)20/h1,15,17,23-24H,6-14H2,2-4H3/t15-,17-,19+,20+,21+/m0/s1 |
| InChIKey | VHZZIUYQVKJVOI-QFOJKKOJSA-N |
| XLogP | 3.47 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|