C21H30O2 — CID 88627008
(4aS)-7-(2-hydroxypropan-2-yl)-7-methyl-4a-prop-2-ynyl-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one (PubChem CID 88627008) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (4aS)-7-(2-hydroxypropan-2-yl)-7-methyl-4a-prop-2-ynyl-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one.
| Compound Name | (4aS)-7-(2-hydroxypropan-2-yl)-7-methyl-4a-prop-2-ynyl-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 88627008 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (4aS)-7-(2-hydroxypropan-2-yl)-7-methyl-4a-prop-2-ynyl-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one |
| SMILES | C#CC[C@]12CCC(=O)C=C1CCC1CC(C)(C(C)(C)O)CCC12 |
| InChI | InChI=1S/C21H30O2/c1-5-10-21-12-8-17(22)13-16(21)7-6-15-14-20(4,19(2,3)23)11-9-18(15)21/h1,13,15,18,23H,6-12,14H2,2-4H3/t15?,18?,20?,21-/m0/s1 |
| InChIKey | XPOOHFOBTVFLET-BGEGTNQOSA-N |
| XLogP | 4.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|