C21H25ClO2 — CID 54087334
(8R,9S,10S,13S,14S)-10-(3-chloroprop-2-ynyl)-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 54087334) has the molecular formula C21H25ClO2 and a molecular weight of 344.88 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-10-(3-chloroprop-2-ynyl)-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10S,13S,14S)-10-(3-chloroprop-2-ynyl)-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 54087334 |
| Molecular Formula | C21H25ClO2 |
| Molecular Weight | 344.88 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (8R,9S,10S,13S,14S)-10-(3-chloroprop-2-ynyl)-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43CC#CCl)[C@@H]1CCC2=O |
| InChI | InChI=1S/C21H25ClO2/c1-20-10-8-18-16(17(20)5-6-19(20)24)4-3-14-13-15(23)7-11-21(14,18)9-2-12-22/h13,16-18H,3-11H2,1H3/t16-,17-,18-,20-,21-/m0/s1 |
| InChIKey | MRKBZZWBBSONEI-OEUJLIAZSA-N |
| XLogP | 4.66 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.88 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|