C23H34O2S — CID 57235062
(8R,9R,10S,13S,14S)-10-(3-ethylsulfanylpropyl)-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57235062) has the molecular formula C23H34O2S and a molecular weight of 374.59 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-10-(3-ethylsulfanylpropyl)-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9R,10S,13S,14S)-10-(3-ethylsulfanylpropyl)-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57235062 |
| Molecular Formula | C23H34O2S |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (8R,9R,10S,13S,14S)-10-(3-ethylsulfanylpropyl)-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CCSCCC[C@]12CCC(=O)C=C1CC[C@@H]1[C@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C23H34O2S/c1-3-26-14-4-11-23-13-9-17(24)15-16(23)5-6-18-19-7-8-21(25)22(19,2)12-10-20(18)23/h15,18-20H,3-14H2,1-2H3/t18-,19-,20+,22-,23-/m0/s1 |
| InChIKey | BECYCUFQSZIBJK-GDXKHXNESA-N |
| XLogP | 5.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|