C14H24O3 — CID 11424984
(4aR,7R)-8a-hydroxy-7-(2-hydroxypropan-2-yl)-4a-methyl-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one (PubChem CID 11424984) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (4aR,7R)-8a-hydroxy-7-(2-hydroxypropan-2-yl)-4a-methyl-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one.
| Compound Name | (4aR,7R)-8a-hydroxy-7-(2-hydroxypropan-2-yl)-4a-methyl-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 11424984 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (4aR,7R)-8a-hydroxy-7-(2-hydroxypropan-2-yl)-4a-methyl-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one |
| SMILES | CC(C)(O)[C@@H]1CC[C@]2(C)CCC(=O)CC2(O)C1 |
| InChI | InChI=1S/C14H24O3/c1-12(2,16)10-4-6-13(3)7-5-11(15)9-14(13,17)8-10/h10,16-17H,4-9H2,1-3H3/t10-,13-,14?/m1/s1 |
| InChIKey | OQCCHICSLUUJRW-AITIGCMRSA-N |
| XLogP | 2.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |