C22H36O3 — CID 162753519
(5S,10R,13S)-17-(1,1-dihydroxyethyl)-5,10,13-trimethyl-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 162753519) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is (5S,10R,13S)-17-(1,1-dihydroxyethyl)-5,10,13-trimethyl-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (5S,10R,13S)-17-(1,1-dihydroxyethyl)-5,10,13-trimethyl-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 162753519 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | (5S,10R,13S)-17-(1,1-dihydroxyethyl)-5,10,13-trimethyl-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(O)(O)C1CCC2C3CC[C@@]4(C)CC(=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C22H36O3/c1-19-10-8-15-16-5-6-18(22(4,24)25)20(16,2)11-9-17(15)21(19,3)12-7-14(23)13-19/h15-18,24-25H,5-13H2,1-4H3/t15?,16?,17?,18?,19-,20-,21+/m0/s1 |
| InChIKey | JWLILEJOJPVFOP-LIASXULMSA-N |
| XLogP | 4.31 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|