C23H34N2O — CID 50852028
(5S)-5,10,13-trimethyl-17-(1H-pyrazol-5-yl)-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 50852028) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is (5S)-5,10,13-trimethyl-17-(1H-pyrazol-5-yl)-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (5S)-5,10,13-trimethyl-17-(1H-pyrazol-5-yl)-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 50852028 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | (5S)-5,10,13-trimethyl-17-(1H-pyrazol-5-yl)-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC12CCC3C(CC[C@@]4(C)CC(=O)CCC34C)C1CCC2c1ccn[nH]1 |
| InChI | InChI=1S/C23H34N2O/c1-21-10-7-16-17-4-5-19(20-9-13-24-25-20)22(17,2)11-8-18(16)23(21,3)12-6-15(26)14-21/h9,13,16-19H,4-8,10-12,14H2,1-3H3,(H,24,25)/t16?,17?,18?,19?,21-,22?,23?/m0/s1 |
| InChIKey | HMMYWGSYCDFMRC-YJMUJLPUSA-N |
| XLogP | 5.50 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |