C23H36O3 — CID 54228090
(3S,5R,8S,9S,10S,13S,14S,17S)-17-[(1S)-1-hydroxyethyl]-13-methyl-10-prop-2-ynyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5-diol (PubChem CID 54228090) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (3S,5R,8S,9S,10S,13S,14S,17S)-17-[(1S)-1-hydroxyethyl]-13-methyl-10-prop-2-ynyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5-diol.
| Compound Name | (3S,5R,8S,9S,10S,13S,14S,17S)-17-[(1S)-1-hydroxyethyl]-13-methyl-10-prop-2-ynyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5-diol |
|---|---|
| PubChem CID | 54228090 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (3S,5R,8S,9S,10S,13S,14S,17S)-17-[(1S)-1-hydroxyethyl]-13-methyl-10-prop-2-ynyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5-diol |
| SMILES | C#CC[C@]12CC[C@H](O)C[C@]1(O)CC[C@H]1[C@@H]3CC[C@H]([C@H](C)O)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C23H36O3/c1-4-10-22-12-7-16(25)14-23(22,26)13-8-17-19-6-5-18(15(2)24)21(19,3)11-9-20(17)22/h1,15-20,24-26H,5-14H2,2-3H3/t15-,16-,17-,18+,19-,20-,21+,22+,23+/m0/s1 |
| InChIKey | QHHHGQLRVLOIPA-SQMMZZNVSA-N |
| XLogP | 3.51 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|