C24H36O3 — CID 142047716
[(3S,7R,11R,13S,17S)-11-ethenyl-3-methoxy-7,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 142047716) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is [(3S,7R,11R,13S,17S)-11-ethenyl-3-methoxy-7,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(3S,7R,11R,13S,17S)-11-ethenyl-3-methoxy-7,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 142047716 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | [(3S,7R,11R,13S,17S)-11-ethenyl-3-methoxy-7,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | C=C[C@H]1C[C@@]2(C)C(CC[C@@H]2OC(C)=O)C2C(C)CC3=C(CC[C@H](OC)C3)C21 |
| InChI | InChI=1S/C24H36O3/c1-6-16-13-24(4)20(9-10-21(24)27-15(3)25)22-14(2)11-17-12-18(26-5)7-8-19(17)23(16)22/h6,14,16,18,20-23H,1,7-13H2,2-5H3/t14?,16-,18-,20?,21-,22?,23?,24-/m0/s1 |
| InChIKey | DUYCOMRCNDOLNU-ACZOBQFMSA-N |
| XLogP | 5.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|