C18H25NaO5S — CID 129009733
sodium;hydride;[(8R,9S,13S,14S,17S)-2,4,16,16-tetradeuterio-17-hydroxy-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate (PubChem CID 129009733) has the molecular formula C18H25NaO5S and a molecular weight of 380.47 g/mol. Its IUPAC name is sodium;hydride;[(8R,9S,13S,14S,17S)-2,4,16,16-tetradeuterio-17-hydroxy-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate.
| Compound Name | sodium;hydride;[(8R,9S,13S,14S,17S)-2,4,16,16-tetradeuterio-17-hydroxy-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 129009733 |
| Molecular Formula | C18H25NaO5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | sodium;hydride;[(8R,9S,13S,14S,17S)-2,4,16,16-tetradeuterio-17-hydroxy-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
| SMILES | [2H]c1cc2c(c([2H])c1OS(=O)(=O)O)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC([2H])([2H])[C@@H]2O.[H-].[Na+] |
| InChI | InChI=1S/C18H24O5S.Na.H/c1-18-9-8-14-13-5-3-12(23-24(20,21)22)10-11(13)2-4-15(14)16(18)6-7-17(18)19;;/h3,5,10,14-17,19H,2,4,6-9H2,1H3,(H,20,21,22);;/q;+1;-1/t14-,15-,16+,17+,18+;;/m1../s1/i3D,7D2,10D;; |
| InChIKey | OVWWFYAVCFRYMP-RRQYNGKMSA-N |
| XLogP | 0.20 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|