C31H34FNO8 — CID 129011241
(2S,4R,5R)-2-[6'-(diethylamino)-4'-(fluoromethyl)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 129011241) has the molecular formula C31H34FNO8 and a molecular weight of 567.61 g/mol. Its IUPAC name is (2S,4R,5R)-2-[6'-(diethylamino)-4'-(fluoromethyl)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,4R,5R)-2-[6'-(diethylamino)-4'-(fluoromethyl)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 129011241 |
| Molecular Formula | C31H34FNO8 |
| Molecular Weight | 567.61 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | (2S,4R,5R)-2-[6'-(diethylamino)-4'-(fluoromethyl)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1c(ccc(O[C@@H]3OC(CO)[C@H](O)[C@@H](O)C3O)c1CF)C21OCc2ccccc21 |
| InChI | InChI=1S/C31H34FNO8/c1-3-33(4-2)18-9-10-21-24(13-18)39-29-19(14-32)23(40-30-28(37)27(36)26(35)25(15-34)41-30)12-11-22(29)31(21)20-8-6-5-7-17(20)16-38-31/h5-13,25-28,30,34-37H,3-4,14-16H2,1-2H3/t25?,26-,27+,28?,30+,31?/m0/s1 |
| InChIKey | SVEDIEUQTRCORD-CEHXFHEISA-N |
| XLogP | 3.11 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.61 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |