C13H17NO6S — CID 54443882
2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzenecarbothioamide (PubChem CID 54443882) has the molecular formula C13H17NO6S and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzenecarbothioamide.
| Compound Name | 2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzenecarbothioamide |
|---|---|
| PubChem CID | 54443882 |
| Molecular Formula | C13H17NO6S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzenecarbothioamide |
| SMILES | NC(=S)c1ccccc1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H17NO6S/c14-12(21)6-3-1-2-4-7(6)19-13-11(18)10(17)9(16)8(5-15)20-13/h1-4,8-11,13,15-18H,5H2,(H2,14,21)/t8-,9-,10+,11-,13+/m1/s1 |
| InChIKey | WQCDPISKWWWWHH-HMUNZLOLSA-N |
| XLogP | -1.50 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|