C8H11Cl2N5 — CID 129011540
1-(4,6-dichloro-1,3,5-triazin-2-yl)piperidin-4-amine (PubChem CID 129011540) has the molecular formula C8H11Cl2N5 and a molecular weight of 248.12 g/mol. Its IUPAC name is 1-(4,6-dichloro-1,3,5-triazin-2-yl)piperidin-4-amine.
| Compound Name | 1-(4,6-dichloro-1,3,5-triazin-2-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 129011540 |
| Molecular Formula | C8H11Cl2N5 |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 1-(4,6-dichloro-1,3,5-triazin-2-yl)piperidin-4-amine |
| SMILES | NC1CCN(c2nc(Cl)nc(Cl)n2)CC1 |
| InChI | InChI=1S/C8H11Cl2N5/c9-6-12-7(10)14-8(13-6)15-3-1-5(11)2-4-15/h5H,1-4,11H2 |
| InChIKey | YOJCYOZKPUBLNH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |