C24H32N6O7S2 — CID 129011808
[1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-5-(1H-indol-3-yl)pentyl]-methylsulfanium;methyl sulfate (PubChem CID 129011808) has the molecular formula C24H32N6O7S2 and a molecular weight of 580.69 g/mol. Its IUPAC name is [1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-5-(1H-indol-3-yl)pentyl]-methylsulfanium;methyl sulfate.
| Compound Name | [1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-5-(1H-indol-3-yl)pentyl]-methylsulfanium;methyl sulfate |
|---|---|
| PubChem CID | 129011808 |
| Molecular Formula | C24H32N6O7S2 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | [1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-5-(1H-indol-3-yl)pentyl]-methylsulfanium;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].C[SH+]C(CCCCc1c[nH]c2ccccc12)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H28N6O3S.CH4O4S/c1-33-16(9-5-2-6-13-10-25-15-8-4-3-7-14(13)15)20-18(30)19(31)23(32-20)29-12-28-17-21(24)26-11-27-22(17)29;1-5-6(2,3)4/h3-4,7-8,10-12,16,18-20,23,25,30-31H,2,5-6,9H2,1H3,(H2,24,26,27);1H3,(H,2,3,4)/t16?,18-,19+,20+,23+;/m0./s1 |
| InChIKey | GTJXAVJAJXKNDY-NTIQLPHSSA-N |
| XLogP | 0.83 |
| TPSA | 201.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|