C16H32O4 — CID 129012081
(2R)-3-[(Z)-1-hydroxytridec-9-enoxy]propane-1,2-diol (PubChem CID 129012081) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is (2R)-3-[(Z)-1-hydroxytridec-9-enoxy]propane-1,2-diol.
| Compound Name | (2R)-3-[(Z)-1-hydroxytridec-9-enoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 129012081 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | (2R)-3-[(Z)-1-hydroxytridec-9-enoxy]propane-1,2-diol |
| SMILES | CCC/C=C\CCCCCCCC(O)OC[C@H](O)CO |
| InChI | InChI=1S/C16H32O4/c1-2-3-4-5-6-7-8-9-10-11-12-16(19)20-14-15(18)13-17/h4-5,15-19H,2-3,6-14H2,1H3/b5-4-/t15-,16?/m1/s1 |
| InChIKey | UMTLMHUVQWJHKK-BRJBXLKLSA-N |
| XLogP | 2.76 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|