C19H26N6O — CID 129012611
6-[3-(tert-butylamino)-2-methylquinoxalin-5-yl]-1,2,3,4a,5,6,7,7a-octahydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 129012611) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 6-[3-(tert-butylamino)-2-methylquinoxalin-5-yl]-1,2,3,4a,5,6,7,7a-octahydropyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 6-[3-(tert-butylamino)-2-methylquinoxalin-5-yl]-1,2,3,4a,5,6,7,7a-octahydropyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 129012611 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 6-[3-(tert-butylamino)-2-methylquinoxalin-5-yl]-1,2,3,4a,5,6,7,7a-octahydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2cccc(C3CC4C(=O)NCNC4N3)c2nc1NC(C)(C)C |
| InChI | InChI=1S/C19H26N6O/c1-10-16(25-19(2,3)4)24-15-11(6-5-7-13(15)22-10)14-8-12-17(23-14)20-9-21-18(12)26/h5-7,12,14,17,20,23H,8-9H2,1-4H3,(H,21,26)(H,24,25) |
| InChIKey | QDMDZOFOVZSFPH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |