C21H30FN3O3 — CID 129014125
2-[3-[4-[(4-fluoro-5-hydroxy-3-oxo-1H-isoindol-2-yl)methyl]cyclohexyl]butylamino]acetamide (PubChem CID 129014125) has the molecular formula C21H30FN3O3 and a molecular weight of 391.49 g/mol. Its IUPAC name is 2-[3-[4-[(4-fluoro-5-hydroxy-3-oxo-1H-isoindol-2-yl)methyl]cyclohexyl]butylamino]acetamide.
| Compound Name | 2-[3-[4-[(4-fluoro-5-hydroxy-3-oxo-1H-isoindol-2-yl)methyl]cyclohexyl]butylamino]acetamide |
|---|---|
| PubChem CID | 129014125 |
| Molecular Formula | C21H30FN3O3 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 2-[3-[4-[(4-fluoro-5-hydroxy-3-oxo-1H-isoindol-2-yl)methyl]cyclohexyl]butylamino]acetamide |
| SMILES | CC(CCNCC(N)=O)C1CCC(CN2Cc3ccc(O)c(F)c3C2=O)CC1 |
| InChI | InChI=1S/C21H30FN3O3/c1-13(8-9-24-10-18(23)27)15-4-2-14(3-5-15)11-25-12-16-6-7-17(26)20(22)19(16)21(25)28/h6-7,13-15,24,26H,2-5,8-12H2,1H3,(H2,23,27) |
| InChIKey | JYWUUNPQJLOUJI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|