C30H36N4O5S — CID 129015221
2-[[3-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylamino]phenyl]-1H-indazol-6-yl]sulfanyl]-N-methylbenzamide (PubChem CID 129015221) has the molecular formula C30H36N4O5S and a molecular weight of 564.71 g/mol. Its IUPAC name is 2-[[3-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylamino]phenyl]-1H-indazol-6-yl]sulfanyl]-N-methylbenzamide.
| Compound Name | 2-[[3-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylamino]phenyl]-1H-indazol-6-yl]sulfanyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 129015221 |
| Molecular Formula | C30H36N4O5S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 2-[[3-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethylamino]phenyl]-1H-indazol-6-yl]sulfanyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1Sc1ccc2c(-c3ccc(NCCOCCOCCOCCOC)cc3)n[nH]c2c1 |
| InChI | InChI=1S/C30H36N4O5S/c1-31-30(35)26-5-3-4-6-28(26)40-24-11-12-25-27(21-24)33-34-29(25)22-7-9-23(10-8-22)32-13-14-37-17-18-39-20-19-38-16-15-36-2/h3-12,21,32H,13-20H2,1-2H3,(H,31,35)(H,33,34) |
| InChIKey | SWKWXKVGFLRFMQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|