C16H12N4O6 — CID 129015457
methyl 2-[2-[(2-nitrophenoxy)amino]-4-pyridinyl]-1,3-oxazole-4-carboxylate (PubChem CID 129015457) has the molecular formula C16H12N4O6 and a molecular weight of 356.29 g/mol. Its IUPAC name is methyl 2-[2-[(2-nitrophenoxy)amino]-4-pyridinyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[2-[(2-nitrophenoxy)amino]-4-pyridinyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 129015457 |
| Molecular Formula | C16H12N4O6 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | methyl 2-[2-[(2-nitrophenoxy)amino]-4-pyridinyl]-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1coc(-c2ccnc(NOc3ccccc3[N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C16H12N4O6/c1-24-16(21)11-9-25-15(18-11)10-6-7-17-14(8-10)19-26-13-5-3-2-4-12(13)20(22)23/h2-9H,1H3,(H,17,19) |
| InChIKey | PUOPIZXIZLOAGU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|