C24H19N3O3 — CID 88958839
methyl 2-[2-(benzhydrylideneamino)-6-methyl-4-pyridinyl]-1,3-oxazole-4-carboxylate (PubChem CID 88958839) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is methyl 2-[2-(benzhydrylideneamino)-6-methyl-4-pyridinyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[2-(benzhydrylideneamino)-6-methyl-4-pyridinyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 88958839 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | methyl 2-[2-(benzhydrylideneamino)-6-methyl-4-pyridinyl]-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1coc(-c2cc(C)nc(N=C(c3ccccc3)c3ccccc3)c2)n1 |
| InChI | InChI=1S/C24H19N3O3/c1-16-13-19(23-26-20(15-30-23)24(28)29-2)14-21(25-16)27-22(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-15H,1-2H3 |
| InChIKey | JRISSFGNDWVQIY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 77.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|