C15H16O3S — CID 129015641
2-(2-hydroxy-4,5-dimethylphenyl)-4-methyl-6-sulfanyloxyphenol (PubChem CID 129015641) has the molecular formula C15H16O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-(2-hydroxy-4,5-dimethylphenyl)-4-methyl-6-sulfanyloxyphenol.
| Compound Name | 2-(2-hydroxy-4,5-dimethylphenyl)-4-methyl-6-sulfanyloxyphenol |
|---|---|
| PubChem CID | 129015641 |
| Molecular Formula | C15H16O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-(2-hydroxy-4,5-dimethylphenyl)-4-methyl-6-sulfanyloxyphenol |
| SMILES | Cc1cc(OS)c(O)c(-c2cc(C)c(C)cc2O)c1 |
| InChI | InChI=1S/C15H16O3S/c1-8-4-12(15(17)14(5-8)18-19)11-6-9(2)10(3)7-13(11)16/h4-7,16-17,19H,1-3H3 |
| InChIKey | AUKANWQAXZLCSS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|