C10H12N2OS — CID 129016100
(Z)-1-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-3-iminoprop-1-en-1-amine (PubChem CID 129016100) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is (Z)-1-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-3-iminoprop-1-en-1-amine.
| Compound Name | (Z)-1-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-3-iminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 129016100 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (Z)-1-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)-3-iminoprop-1-en-1-amine |
| SMILES | [H]/N=C/C=C(\N)C1OCCc2sccc21 |
| InChI | InChI=1S/C10H12N2OS/c11-4-1-8(12)10-7-3-6-14-9(7)2-5-13-10/h1,3-4,6,10-11H,2,5,12H2/b8-1-,11-4+ |
| InChIKey | JRWAWOVEEDQHDU-MLSOZZCESA-N |
| XLogP | 1.85 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|