C10H17NOS — CID 129016110
(6S)-6-(aminomethyl)-4-[(Z)-but-2-en-2-yl]-3,6-dihydro-2H-pyran-5-thiol (PubChem CID 129016110) has the molecular formula C10H17NOS and a molecular weight of 199.32 g/mol. Its IUPAC name is (6S)-6-(aminomethyl)-4-[(Z)-but-2-en-2-yl]-3,6-dihydro-2H-pyran-5-thiol.
| Compound Name | (6S)-6-(aminomethyl)-4-[(Z)-but-2-en-2-yl]-3,6-dihydro-2H-pyran-5-thiol |
|---|---|
| PubChem CID | 129016110 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (6S)-6-(aminomethyl)-4-[(Z)-but-2-en-2-yl]-3,6-dihydro-2H-pyran-5-thiol |
| SMILES | C/C=C(/C)C1=C(S)[C@H](CN)OCC1 |
| InChI | InChI=1S/C10H17NOS/c1-3-7(2)8-4-5-12-9(6-11)10(8)13/h3,9,13H,4-6,11H2,1-2H3/b7-3-/t9-/m0/s1 |
| InChIKey | HEUBXBYDJRDHPC-XGLGWPIMSA-N |
| XLogP | 1.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|