C13H23NO — CID 129015898
[(3E,4Z)-3-ethylidene-4-pentylideneoxan-2-yl]methanamine (PubChem CID 129015898) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is [(3E,4Z)-3-ethylidene-4-pentylideneoxan-2-yl]methanamine.
| Compound Name | [(3E,4Z)-3-ethylidene-4-pentylideneoxan-2-yl]methanamine |
|---|---|
| PubChem CID | 129015898 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | [(3E,4Z)-3-ethylidene-4-pentylideneoxan-2-yl]methanamine |
| SMILES | C/C=C1C(=C/CCCC)\CCOC\1CN |
| InChI | InChI=1S/C13H23NO/c1-3-5-6-7-11-8-9-15-13(10-14)12(11)4-2/h4,7,13H,3,5-6,8-10,14H2,1-2H3/b11-7-,12-4+ |
| InChIKey | VWSJEOWYZOTBCS-ZJVGSOJOSA-N |
| XLogP | 2.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|