C10H20F2N2O2 — CID 129016942
(3S)-3-[amino(dimethylamino)methoxy]-5-(difluoromethyl)cyclohexan-1-ol (PubChem CID 129016942) has the molecular formula C10H20F2N2O2 and a molecular weight of 238.28 g/mol. Its IUPAC name is (3S)-3-[amino(dimethylamino)methoxy]-5-(difluoromethyl)cyclohexan-1-ol.
| Compound Name | (3S)-3-[amino(dimethylamino)methoxy]-5-(difluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 129016942 |
| Molecular Formula | C10H20F2N2O2 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (3S)-3-[amino(dimethylamino)methoxy]-5-(difluoromethyl)cyclohexan-1-ol |
| SMILES | CN(C)C(N)O[C@@H]1CC(O)CC(C(F)F)C1 |
| InChI | InChI=1S/C10H20F2N2O2/c1-14(2)10(13)16-8-4-6(9(11)12)3-7(15)5-8/h6-10,15H,3-5,13H2,1-2H3/t6?,7?,8-,10?/m0/s1 |
| InChIKey | WJUMSCZUMLHXON-ZYOAUOPZSA-N |
| XLogP | 0.60 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|