C6H8Br2O4 — CID 129017895
2-(1,2-dibromopropyl)propanedioic acid (PubChem CID 129017895) has the molecular formula C6H8Br2O4 and a molecular weight of 303.93 g/mol. Its IUPAC name is 2-(1,2-dibromopropyl)propanedioic acid.
| Compound Name | 2-(1,2-dibromopropyl)propanedioic acid |
|---|---|
| PubChem CID | 129017895 |
| Molecular Formula | C6H8Br2O4 |
| Molecular Weight | 303.93 g/mol |
| Exact Mass | 301.88 |
| IUPAC Name | 2-(1,2-dibromopropyl)propanedioic acid |
| SMILES | CC(Br)C(Br)C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8Br2O4/c1-2(7)4(8)3(5(9)10)6(11)12/h2-4H,1H3,(H,9,10)(H,11,12) |
| InChIKey | LYXOZUYLDBESCR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.93 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|