About (Z)-5-ethyl-3,5-dimethylnon-3-en-8-yn-4-ol
(Z)-5-ethyl-3,5-dimethylnon-3-en-8-yn-4-ol (PubChem CID 129019334) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is (Z)-5-ethyl-3,5-dimethylnon-3-en-8-yn-4-ol.
Molecular Properties
| Compound Name | (Z)-5-ethyl-3,5-dimethylnon-3-en-8-yn-4-ol |
| PubChem CID | 129019334 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (Z)-5-ethyl-3,5-dimethylnon-3-en-8-yn-4-ol |
| SMILES | C#CCCC(C)(CC)/C(O)=C(\C)CC |
| InChI | InChI=1S/C13H22O/c1-6-9-10-13(5,8-3)12(14)11(4)7-2/h1,14H,7-10H2,2-5H3/b12-11- |
| InChIKey | ZZJBEYOUSSERQA-QXMHVHEDSA-N |
| XLogP | 4.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5-ethyl-3,5-dimethylnon-3-en-8-yn-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5-ethyl-3,5-dimethylnon-3-en-8-yn-4-ol?
The IUPAC name of (Z)-5-ethyl-3,5-dimethylnon-3-en-8-yn-4-ol (CID 129019334) is (Z)-5-ethyl-3,5-dimethylnon-3-en-8-yn-4-ol.
What is the SMILES notation for (Z)-5-ethyl-3,5-dimethylnon-3-en-8-yn-4-ol?
The canonical SMILES for (Z)-5-ethyl-3,5-dimethylnon-3-en-8-yn-4-ol is C#CCCC(C)(CC)/C(O)=C(\C)CC.
What is the InChIKey of (Z)-5-ethyl-3,5-dimethylnon-3-en-8-yn-4-ol?
The InChIKey is ZZJBEYOUSSERQA-QXMHVHEDSA-N. The full InChI is InChI=1S/C13H22O/c1-6-9-10-13(5,8-3)12(14)11(4)7-2/h1,14H,7-10H2,2-5H3/b12-11-.
What are the key properties of (Z)-5-ethyl-3,5-dimethylnon-3-en-8-yn-4-ol?
(Z)-5-ethyl-3,5-dimethylnon-3-en-8-yn-4-ol has a molecular weight of 194.32 g/mol, XLogP of 4.06, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5-ethyl-3,5-dimethylnon-3-en-8-yn-4-ol is sourced from PubChem (CID 129019334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).