C13H24O4 — CID 122583490
5,5-bis(hydroxymethyl)-3,7-dimethylnona-3,6-diene-4,6-diol (PubChem CID 122583490) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is 5,5-bis(hydroxymethyl)-3,7-dimethylnona-3,6-diene-4,6-diol.
| Compound Name | 5,5-bis(hydroxymethyl)-3,7-dimethylnona-3,6-diene-4,6-diol |
|---|---|
| PubChem CID | 122583490 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 5,5-bis(hydroxymethyl)-3,7-dimethylnona-3,6-diene-4,6-diol |
| SMILES | CCC(C)=C(O)C(CO)(CO)C(O)=C(C)CC |
| InChI | InChI=1S/C13H24O4/c1-5-9(3)11(16)13(7-14,8-15)12(17)10(4)6-2/h14-17H,5-8H2,1-4H3 |
| InChIKey | SMYYHUKZVFEJGF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|