C32H30BrClN2O4 — CID 129019894
5-[[5-[[3-[3-(3-bromopropoxy)-2-methylphenyl]-2-methylphenyl]methoxy]-4-chloro-2-(hydroxymethyl)phenoxy]methyl]pyridine-3-carbonitrile (PubChem CID 129019894) has the molecular formula C32H30BrClN2O4 and a molecular weight of 621.96 g/mol. Its IUPAC name is 5-[[5-[[3-[3-(3-bromopropoxy)-2-methylphenyl]-2-methylphenyl]methoxy]-4-chloro-2-(hydroxymethyl)phenoxy]methyl]pyridine-3-carbonitrile.
| Compound Name | 5-[[5-[[3-[3-(3-bromopropoxy)-2-methylphenyl]-2-methylphenyl]methoxy]-4-chloro-2-(hydroxymethyl)phenoxy]methyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 129019894 |
| Molecular Formula | C32H30BrClN2O4 |
| Molecular Weight | 621.96 g/mol |
| Exact Mass | 620.11 |
| IUPAC Name | 5-[[5-[[3-[3-(3-bromopropoxy)-2-methylphenyl]-2-methylphenyl]methoxy]-4-chloro-2-(hydroxymethyl)phenoxy]methyl]pyridine-3-carbonitrile |
| SMILES | Cc1c(COc2cc(OCc3cncc(C#N)c3)c(CO)cc2Cl)cccc1-c1cccc(OCCCBr)c1C |
| InChI | InChI=1S/C32H30BrClN2O4/c1-21-25(6-3-7-27(21)28-8-4-9-30(22(28)2)38-11-5-10-33)20-40-32-14-31(26(18-37)13-29(32)34)39-19-24-12-23(15-35)16-36-17-24/h3-4,6-9,12-14,16-17,37H,5,10-11,18-20H2,1-2H3 |
| InChIKey | MMCGVDWZFNZCAT-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.96 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|