C31H24BrCl3N2O4 — CID 129020485
5-[[5-[[3-[3-(3-bromopropoxy)-2-methylphenyl]-2,4-dichlorophenyl]methoxy]-4-chloro-2-formylphenoxy]methyl]pyridine-3-carbonitrile (PubChem CID 129020485) has the molecular formula C31H24BrCl3N2O4 and a molecular weight of 674.81 g/mol. Its IUPAC name is 5-[[5-[[3-[3-(3-bromopropoxy)-2-methylphenyl]-2,4-dichlorophenyl]methoxy]-4-chloro-2-formylphenoxy]methyl]pyridine-3-carbonitrile.
| Compound Name | 5-[[5-[[3-[3-(3-bromopropoxy)-2-methylphenyl]-2,4-dichlorophenyl]methoxy]-4-chloro-2-formylphenoxy]methyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 129020485 |
| Molecular Formula | C31H24BrCl3N2O4 |
| Molecular Weight | 674.81 g/mol |
| Exact Mass | 672.00 |
| IUPAC Name | 5-[[5-[[3-[3-(3-bromopropoxy)-2-methylphenyl]-2,4-dichlorophenyl]methoxy]-4-chloro-2-formylphenoxy]methyl]pyridine-3-carbonitrile |
| SMILES | Cc1c(OCCCBr)cccc1-c1c(Cl)ccc(COc2cc(OCc3cncc(C#N)c3)c(C=O)cc2Cl)c1Cl |
| InChI | InChI=1S/C31H24BrCl3N2O4/c1-19-24(4-2-5-27(19)39-9-3-8-32)30-25(33)7-6-22(31(30)35)18-41-29-12-28(23(16-38)11-26(29)34)40-17-21-10-20(13-36)14-37-15-21/h2,4-7,10-12,14-16H,3,8-9,17-18H2,1H3 |
| InChIKey | FCUJZBBYBFVOJH-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 81.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.81 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|