C22H16BrClN2O3 — CID 135361639
5-[[5-[(3-bromo-2-methylphenoxy)methyl]-4-chloro-2-formylphenoxy]methyl]pyridine-3-carbonitrile (PubChem CID 135361639) has the molecular formula C22H16BrClN2O3 and a molecular weight of 471.74 g/mol. Its IUPAC name is 5-[[5-[(3-bromo-2-methylphenoxy)methyl]-4-chloro-2-formylphenoxy]methyl]pyridine-3-carbonitrile.
| Compound Name | 5-[[5-[(3-bromo-2-methylphenoxy)methyl]-4-chloro-2-formylphenoxy]methyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135361639 |
| Molecular Formula | C22H16BrClN2O3 |
| Molecular Weight | 471.74 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | 5-[[5-[(3-bromo-2-methylphenoxy)methyl]-4-chloro-2-formylphenoxy]methyl]pyridine-3-carbonitrile |
| SMILES | Cc1c(Br)cccc1OCc1cc(OCc2cncc(C#N)c2)c(C=O)cc1Cl |
| InChI | InChI=1S/C22H16BrClN2O3/c1-14-19(23)3-2-4-21(14)29-13-18-7-22(17(11-27)6-20(18)24)28-12-16-5-15(8-25)9-26-10-16/h2-7,9-11H,12-13H2,1H3 |
| InChIKey | LHYFIZWWOJSHJD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.74 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|