C32H25BrN2O4 — CID 168917105
5-[[4-bromo-2-formyl-5-[[2-methyl-3-(2-methyl-3-prop-2-ynoxyphenyl)phenyl]methoxy]phenoxy]methyl]pyridine-3-carbonitrile (PubChem CID 168917105) has the molecular formula C32H25BrN2O4 and a molecular weight of 581.47 g/mol. Its IUPAC name is 5-[[4-bromo-2-formyl-5-[[2-methyl-3-(2-methyl-3-prop-2-ynoxyphenyl)phenyl]methoxy]phenoxy]methyl]pyridine-3-carbonitrile.
| Compound Name | 5-[[4-bromo-2-formyl-5-[[2-methyl-3-(2-methyl-3-prop-2-ynoxyphenyl)phenyl]methoxy]phenoxy]methyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168917105 |
| Molecular Formula | C32H25BrN2O4 |
| Molecular Weight | 581.47 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | 5-[[4-bromo-2-formyl-5-[[2-methyl-3-(2-methyl-3-prop-2-ynoxyphenyl)phenyl]methoxy]phenoxy]methyl]pyridine-3-carbonitrile |
| SMILES | C#CCOc1cccc(-c2cccc(COc3cc(OCc4cncc(C#N)c4)c(C=O)cc3Br)c2C)c1C |
| InChI | InChI=1S/C32H25BrN2O4/c1-4-11-37-30-10-6-9-28(22(30)3)27-8-5-7-25(21(27)2)20-39-32-14-31(26(18-36)13-29(32)33)38-19-24-12-23(15-34)16-35-17-24/h1,5-10,12-14,16-18H,11,19-20H2,2-3H3 |
| InChIKey | DVCIOEJSRHVNEK-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 81.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.47 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|