C23H16BrFN2O2 — CID 146295489
5-[[5-[2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-2-formylphenoxy]methyl]pyridine-3-carbonitrile (PubChem CID 146295489) has the molecular formula C23H16BrFN2O2 and a molecular weight of 451.30 g/mol. Its IUPAC name is 5-[[5-[2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-2-formylphenoxy]methyl]pyridine-3-carbonitrile.
| Compound Name | 5-[[5-[2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-2-formylphenoxy]methyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 146295489 |
| Molecular Formula | C23H16BrFN2O2 |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | 5-[[5-[2-(3-bromo-2-methylphenyl)-1-fluoroethenyl]-2-formylphenoxy]methyl]pyridine-3-carbonitrile |
| SMILES | Cc1c(Br)cccc1C=C(F)c1ccc(C=O)c(OCc2cncc(C#N)c2)c1 |
| InChI | InChI=1S/C23H16BrFN2O2/c1-15-18(3-2-4-21(15)24)8-22(25)19-5-6-20(13-28)23(9-19)29-14-17-7-16(10-26)11-27-12-17/h2-9,11-13H,14H2,1H3 |
| InChIKey | LCGHQZHZPXGDOQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|